C21H22FN5O3S — CID 67343353
1-[10-(benzenesulfonyl)-3-[(3R)-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 67343353) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is 1-[10-(benzenesulfonyl)-3-[(3R)-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | 1-[10-(benzenesulfonyl)-3-[(3R)-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 67343353 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[10-(benzenesulfonyl)-3-[(3R)-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | CC(O)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCNC[C@H]1F |
| InChI | InChI=1S/C21H22FN5O3S/c1-13(28)20-25-17-12-24-21-15(19(17)27(20)18-7-9-23-11-16(18)22)8-10-26(21)31(29,30)14-5-3-2-4-6-14/h2-6,8,10,12-13,16,18,23,28H,7,9,11H2,1H3/t13?,16-,18?/m1/s1 |
| InChIKey | RZYLAOJCIWULPD-CRPOECCBSA-N |
| XLogP | 2.55 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |