C30H37N5O3SSi — CID 67343795
CID 67343795 (PubChem CID 67343795) has the molecular formula C30H37N5O3SSi and a molecular weight of 575.81 g/mol.
| Compound Name | CID 67343795 |
|---|---|
| PubChem CID | 67343795 |
| Molecular Formula | C30H37N5O3SSi |
| Molecular Weight | 575.81 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCC(CCC#N)CC1 |
| InChI | InChI=1S/C30H37N5O3SSi/c1-29(2,3)40-38-30(4,5)28-33-25-20-32-27-24(17-19-34(27)39(36,37)23-11-7-6-8-12-23)26(25)35(28)22-15-13-21(14-16-22)10-9-18-31/h6-8,11-12,17,19-22H,9-10,13-16H2,1-5H3 |
| InChIKey | YRBDPTFFONVUOT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 102.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.81 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|