C29H36N4O5SSi — CID 67346302
CID 67346302 (PubChem CID 67346302) has the molecular formula C29H36N4O5SSi and a molecular weight of 580.78 g/mol.
| Compound Name | CID 67346302 |
|---|---|
| PubChem CID | 67346302 |
| Molecular Formula | C29H36N4O5SSi |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | — |
| SMILES | COC(=O)C1CCC(n2c(C(C)(C)O[Si]C(C)(C)C)nc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CC1 |
| InChI | InChI=1S/C29H36N4O5SSi/c1-28(2,3)40-38-29(4,5)27-31-23-18-30-25-22(16-17-32(25)39(35,36)21-10-8-7-9-11-21)24(23)33(27)20-14-12-19(13-15-20)26(34)37-6/h7-11,16-20H,12-15H2,1-6H3 |
| InChIKey | JFKALAFULUJCRV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|