C27H32N6O5S — CID 67344393
tert-butyl 4-[4-(acetamidomethyl)-10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate (PubChem CID 67344393) has the molecular formula C27H32N6O5S and a molecular weight of 552.66 g/mol. Its IUPAC name is tert-butyl 4-[4-(acetamidomethyl)-10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(acetamidomethyl)-10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67344393 |
| Molecular Formula | C27H32N6O5S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | tert-butyl 4-[4-(acetamidomethyl)-10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
| SMILES | CC(=O)NCc1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H32N6O5S/c1-18(34)28-17-23-30-22-16-29-25-21(12-15-32(25)39(36,37)20-8-6-5-7-9-20)24(22)33(23)19-10-13-31(14-11-19)26(35)38-27(2,3)4/h5-9,12,15-16,19H,10-11,13-14,17H2,1-4H3,(H,28,34) |
| InChIKey | WIWZALGGNLCQSW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |