C35H31N5O4S2 — CID 146193303
2-[4-[10-(benzenesulfonyl)-4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 146193303) has the molecular formula C35H31N5O4S2 and a molecular weight of 649.80 g/mol. Its IUPAC name is 2-[4-[10-(benzenesulfonyl)-4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[10-(benzenesulfonyl)-4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 146193303 |
| Molecular Formula | C35H31N5O4S2 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 2-[4-[10-(benzenesulfonyl)-4-[4-(4-methylsulfonylphenyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(-c3nc4cnc5c(ccn5S(=O)(=O)c5ccccc5)c4n3C3CCC(CC#N)CC3)cc2)cc1 |
| InChI | InChI=1S/C35H31N5O4S2/c1-45(41,42)29-17-13-26(14-18-29)25-9-11-27(12-10-25)34-38-32-23-37-35-31(20-22-39(35)46(43,44)30-5-3-2-4-6-30)33(32)40(34)28-15-7-24(8-16-28)19-21-36/h2-6,9-14,17-18,20,22-24,28H,7-8,15-16,19H2,1H3 |
| InChIKey | ZOKCKSBYRAGRFI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 127.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |