C34H38N6O4S — CID 175822926
[10-(benzenesulfonyl)-3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl N-(1-adamantyl)carbamate (PubChem CID 175822926) has the molecular formula C34H38N6O4S and a molecular weight of 626.78 g/mol. Its IUPAC name is [10-(benzenesulfonyl)-3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl N-(1-adamantyl)carbamate.
| Compound Name | [10-(benzenesulfonyl)-3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 175822926 |
| Molecular Formula | C34H38N6O4S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | [10-(benzenesulfonyl)-3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl N-(1-adamantyl)carbamate |
| SMILES | N#CCC1CCC(n2c(COC(=O)NC34CC5CC(CC(C5)C3)C4)nc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CC1 |
| InChI | InChI=1S/C34H38N6O4S/c35-12-10-22-6-8-26(9-7-22)40-30(21-44-33(41)38-34-17-23-14-24(18-34)16-25(15-23)19-34)37-29-20-36-32-28(31(29)40)11-13-39(32)45(42,43)27-4-2-1-3-5-27/h1-5,11,13,20,22-26H,6-10,14-19,21H2,(H,38,41) |
| InChIKey | APDXBCQHRYDADY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |