C20H22N6O — CID 53341006
[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol (PubChem CID 53341006) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol.
| Compound Name | [3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol |
|---|---|
| PubChem CID | 53341006 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methanol |
| SMILES | OCc1nc2cnc3[nH]ccc3c2n1C1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C20H22N6O/c27-13-18-24-17-11-23-20-16(3-7-22-20)19(17)26(18)15-4-8-25(9-5-15)12-14-2-1-6-21-10-14/h1-3,6-7,10-11,15,27H,4-5,8-9,12-13H2,(H,22,23) |
| InChIKey | STCUVLAHXQEBJV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |