C20H22N6 — CID 58394895
N-(pyridin-3-ylmethyl)-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-amine (PubChem CID 58394895) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-amine.
| Compound Name | N-(pyridin-3-ylmethyl)-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 58394895 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-amine |
| SMILES | c1cncc(CNC2CCC(n3cnc4cnc5[nH]ccc5c43)CC2)c1 |
| InChI | InChI=1S/C20H22N6/c1-2-14(10-21-8-1)11-23-15-3-5-16(6-4-15)26-13-25-18-12-24-20-17(19(18)26)7-9-22-20/h1-2,7-10,12-13,15-16,23H,3-6,11H2,(H,22,24) |
| InChIKey | PNSFXOKPBHJISE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |