C20H26N6O2 — CID 140566229
(2R)-2-[[[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]amino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 140566229) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is (2R)-2-[[[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]amino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[[[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]amino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 140566229 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2R)-2-[[[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]amino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@@H]1CNC1CCC(n2cnc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C20H26N6O2/c27-20(28)25-9-1-2-15(25)10-22-13-3-5-14(6-4-13)26-12-24-17-11-23-19-16(18(17)26)7-8-21-19/h7-8,11-15,22H,1-6,9-10H2,(H,21,23)(H,27,28)/t13?,14?,15-/m1/s1 |
| InChIKey | IONUWQTXZNLUJH-YMAMQOFZSA-N |
| XLogP | 3.13 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |