C17H22N6O — CID 67352630
N,N-dimethyl-2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]acetamide (PubChem CID 67352630) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 67352630 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N,N-dimethyl-2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCCC(n2cnc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C17H22N6O/c1-21(2)15(24)10-22-7-3-4-12(9-22)23-11-20-14-8-19-17-13(16(14)23)5-6-18-17/h5-6,8,11-12H,3-4,7,9-10H2,1-2H3,(H,18,19) |
| InChIKey | DNVULIGDMOXVPX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |