C19H20N6 — CID 58395408
3-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58395408) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 3-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58395408 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | c1cncc(CN2CCC[C@@H](n3cnc4cnc5[nH]ccc5c43)C2)c1 |
| InChI | InChI=1S/C19H20N6/c1-3-14(9-20-6-1)11-24-8-2-4-15(12-24)25-13-23-17-10-22-19-16(18(17)25)5-7-21-19/h1,3,5-7,9-10,13,15H,2,4,8,11-12H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | VUIOCSULSIXMLV-OAHLLOKOSA-N |
| XLogP | 3.14 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |