C20H19N5O — CID 67345177
1-benzyl-5-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-2-one (PubChem CID 67345177) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-benzyl-5-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-2-one.
| Compound Name | 1-benzyl-5-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 67345177 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-benzyl-5-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-2-one |
| SMILES | O=C1CCC(n2cnc3cnc4[nH]ccc4c32)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H19N5O/c26-18-7-6-15(12-24(18)11-14-4-2-1-3-5-14)25-13-23-17-10-22-20-16(19(17)25)8-9-21-20/h1-5,8-10,13,15H,6-7,11-12H2,(H,21,22) |
| InChIKey | YKKVZFJXSYXIII-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |