C18H20N6O — CID 58394521
2,2-dimethyl-3-oxo-3-[(3R)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]propanenitrile (PubChem CID 58394521) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-[(3R)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]propanenitrile.
| Compound Name | 2,2-dimethyl-3-oxo-3-[(3R)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 58394521 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-[(3R)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]propanenitrile |
| SMILES | CC(C)(C#N)C(=O)N1CCC[C@@H](n2cnc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C18H20N6O/c1-18(2,10-19)17(25)23-7-3-4-12(9-23)24-11-22-14-8-21-16-13(15(14)24)5-6-20-16/h5-6,8,11-12H,3-4,7,9H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | NWFDOBHRLPAEJH-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |