C20H20N6O — CID 58394882
N-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]pyridine-4-carboxamide (PubChem CID 58394882) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]pyridine-4-carboxamide.
| Compound Name | N-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58394882 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]pyridine-4-carboxamide |
| SMILES | O=C(NC1CCC(n2cnc3cnc4[nH]ccc4c32)CC1)c1ccncc1 |
| InChI | InChI=1S/C20H20N6O/c27-20(13-5-8-21-9-6-13)25-14-1-3-15(4-2-14)26-12-24-17-11-23-19-16(18(17)26)7-10-22-19/h5-12,14-15H,1-4H2,(H,22,23)(H,25,27) |
| InChIKey | WSSAXTIDDDVLSR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |