C18H19N7 — CID 53341008
3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene (PubChem CID 53341008) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene.
| Compound Name | 3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 53341008 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
| SMILES | c1cncc(CN2CCC(n3[nH]nc4cnc5nccc5c43)CC2)c1 |
| InChI | InChI=1S/C18H19N7/c1-2-13(10-19-6-1)12-24-8-4-14(5-9-24)25-17-15-3-7-20-18(15)21-11-16(17)22-23-25/h1-3,6-7,10-11,14,23H,4-5,8-9,12H2 |
| InChIKey | FMFJSHNQCAHLFP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |