C15H17N5O2 — CID 140566227
[(1S,3S)-3-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]carbamic acid (PubChem CID 140566227) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [(1S,3S)-3-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]carbamic acid.
| Compound Name | [(1S,3S)-3-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 140566227 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1S,3S)-3-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]carbamic acid |
| SMILES | Cc1nc2cnc3[nH]ccc3c2n1[C@H]1CC[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C15H17N5O2/c1-8-18-12-7-17-14-11(4-5-16-14)13(12)20(8)10-3-2-9(6-10)19-15(21)22/h4-5,7,9-10,19H,2-3,6H2,1H3,(H,16,17)(H,21,22)/t9-,10-/m0/s1 |
| InChIKey | POISZTKPVQEIKS-UWVGGRQHSA-N |
| XLogP | 2.58 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |