C21H23N5O4S2 — CID 156789286
N-methyl-1-[3-[4-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclobutyl]methanesulfonamide (PubChem CID 156789286) has the molecular formula C21H23N5O4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-methyl-1-[3-[4-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclobutyl]methanesulfonamide.
| Compound Name | N-methyl-1-[3-[4-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclobutyl]methanesulfonamide |
|---|---|
| PubChem CID | 156789286 |
| Molecular Formula | C21H23N5O4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-methyl-1-[3-[4-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclobutyl]methanesulfonamide |
| SMILES | CNS(=O)(=O)CC1CC(n2c(S(=O)(=O)c3ccccc3C)nc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C21H23N5O4S2/c1-13-5-3-4-6-18(13)32(29,30)21-25-17-11-24-20-16(7-8-23-20)19(17)26(21)15-9-14(10-15)12-31(27,28)22-2/h3-8,11,14-15,22H,9-10,12H2,1-2H3,(H,23,24) |
| InChIKey | NDWMUTUXWKRONQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |