C25H26N6O2S — CID 67347555
1-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidine-3-carbonitrile (PubChem CID 67347555) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidine-3-carbonitrile.
| Compound Name | 1-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 67347555 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-[4-[4-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidine-3-carbonitrile |
| SMILES | N#CC1CCN(C2CCC(n3c(S(=O)(=O)c4ccccc4)nc4cnc5[nH]ccc5c43)CC2)C1 |
| InChI | InChI=1S/C25H26N6O2S/c26-14-17-11-13-30(16-17)18-6-8-19(9-7-18)31-23-21-10-12-27-24(21)28-15-22(23)29-25(31)34(32,33)20-4-2-1-3-5-20/h1-5,10,12,15,17-19H,6-9,11,13,16H2,(H,27,28) |
| InChIKey | MZLLRIWNVOVMGN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |