C30H25N5O2 — CID 146193363
2-[4-[4-[4-(4-formylbenzoyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 146193363) has the molecular formula C30H25N5O2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-formylbenzoyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[4-[4-(4-formylbenzoyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 146193363 |
| Molecular Formula | C30H25N5O2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 2-[4-[4-[4-(4-formylbenzoyl)phenyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | N#CCC1CCC(n2c(-c3ccc(C(=O)c4ccc(C=O)cc4)cc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C30H25N5O2/c31-15-13-19-3-11-24(12-4-19)35-27-25-14-16-32-29(25)33-17-26(27)34-30(35)23-9-7-22(8-10-23)28(37)21-5-1-20(18-36)2-6-21/h1-2,5-10,14,16-19,24H,3-4,11-13H2,(H,32,33) |
| InChIKey | KVDILSYEBISUHN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|