C22H26N6O2S — CID 67344920
N-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide (PubChem CID 67344920) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 67344920 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC(c1nc2c(cnc3[nH]ccc32)[nH]1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N6O2S/c1-31(29,30)27-19(16-8-11-28(12-9-16)14-15-5-3-2-4-6-15)22-25-18-13-24-21-17(7-10-23-21)20(18)26-22/h2-7,10,13,16,19,27H,8-9,11-12,14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | SWEMVQCVHZJVEX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |