C25H28N6O — CID 67344868
1-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]pyrrolidin-2-one (PubChem CID 67344868) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67344868 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[(1-benzylpiperidin-4-yl)-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(c1nc2c(cnc3[nH]ccc32)[nH]1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N6O/c32-21-7-4-12-31(21)23(18-9-13-30(14-10-18)16-17-5-2-1-3-6-17)25-28-20-15-27-24-19(8-11-26-24)22(20)29-25/h1-3,5-6,8,11,15,18,23H,4,7,9-10,12-14,16H2,(H,26,27)(H,28,29) |
| InChIKey | VVBFCKQCNHEYSM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |