C28H29N5O5S2 — CID 87364630
[[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-(1-benzylpiperidin-4-yl)methyl] methanesulfonate (PubChem CID 87364630) has the molecular formula C28H29N5O5S2 and a molecular weight of 579.70 g/mol. Its IUPAC name is [[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-(1-benzylpiperidin-4-yl)methyl] methanesulfonate.
| Compound Name | [[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-(1-benzylpiperidin-4-yl)methyl] methanesulfonate |
|---|---|
| PubChem CID | 87364630 |
| Molecular Formula | C28H29N5O5S2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | [[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-(1-benzylpiperidin-4-yl)methyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(c1nc2c(cnc3c2ccn3S(=O)(=O)c2ccccc2)[nH]1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H29N5O5S2/c1-39(34,35)38-26(21-12-15-32(16-13-21)19-20-8-4-2-5-9-20)27-30-24-18-29-28-23(25(24)31-27)14-17-33(28)40(36,37)22-10-6-3-7-11-22/h2-11,14,17-18,21,26H,12-13,15-16,19H2,1H3,(H,30,31) |
| InChIKey | JLIGXLJRJGFIOU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|