C19H27N7O2 — CID 150793312
1-tert-butyl-3-[(3R)-1-[4-[(1R)-1-hydroxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]urea (PubChem CID 150793312) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[(3R)-1-[4-[(1R)-1-hydroxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]urea.
| Compound Name | 1-tert-butyl-3-[(3R)-1-[4-[(1R)-1-hydroxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 150793312 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-tert-butyl-3-[(3R)-1-[4-[(1R)-1-hydroxyethyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]urea |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1N1CC[C@@H](NC(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C19H27N7O2/c1-11(27)17-23-14-9-21-16-13(5-7-20-16)15(14)26(17)25-8-6-12(10-25)22-18(28)24-19(2,3)4/h5,7,9,11-12,27H,6,8,10H2,1-4H3,(H,20,21)(H2,22,24,28)/t11-,12-/m1/s1 |
| InChIKey | KEHQAXULDBJYTA-VXGBXAGGSA-N |
| XLogP | 1.77 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |