C22H27N7O5 — CID 174212957
1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl 5-nitrooxypentanoate (PubChem CID 174212957) has the molecular formula C22H27N7O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is 1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl 5-nitrooxypentanoate.
| Compound Name | 1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 174212957 |
| Molecular Formula | C22H27N7O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl 5-nitrooxypentanoate |
| SMILES | CC(OC(=O)CCCCO[N+](=O)[O-])c1nc2cnc3[nH]ccc3c2n1N1CCC(CC#N)CC1 |
| InChI | InChI=1S/C22H27N7O5/c1-15(34-19(30)4-2-3-13-33-29(31)32)22-26-18-14-25-21-17(6-10-24-21)20(18)28(22)27-11-7-16(5-9-23)8-12-27/h6,10,14-16H,2-5,7-8,11-13H2,1H3,(H,24,25) |
| InChIKey | QKXRFAHBCIVKID-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|