C16H20N8O2S — CID 170959061
N-[[1-(4-amino-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-4-yl]methyl]-1-cyanomethanesulfonamide (PubChem CID 170959061) has the molecular formula C16H20N8O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[[1-(4-amino-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-4-yl]methyl]-1-cyanomethanesulfonamide.
| Compound Name | N-[[1-(4-amino-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-4-yl]methyl]-1-cyanomethanesulfonamide |
|---|---|
| PubChem CID | 170959061 |
| Molecular Formula | C16H20N8O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[[1-(4-amino-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-4-yl]methyl]-1-cyanomethanesulfonamide |
| SMILES | N#CCS(=O)(=O)NCC1CCN(n2c(N)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C16H20N8O2S/c17-4-8-27(25,26)21-9-11-2-6-23(7-3-11)24-14-12-1-5-19-15(12)20-10-13(14)22-16(24)18/h1,5,10-11,21H,2-3,6-9H2,(H2,18,22)(H,19,20) |
| InChIKey | WWPDMXCBNBMGQK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |