C22H27N7O4 — CID 174210857
[(1R)-1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl] 5-nitropentanoate (PubChem CID 174210857) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is [(1R)-1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl] 5-nitropentanoate.
| Compound Name | [(1R)-1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl] 5-nitropentanoate |
|---|---|
| PubChem CID | 174210857 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [(1R)-1-[3-[4-(cyanomethyl)piperidin-1-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl] 5-nitropentanoate |
| SMILES | C[C@@H](OC(=O)CCCC[N+](=O)[O-])c1nc2cnc3[nH]ccc3c2n1N1CCC(CC#N)CC1 |
| InChI | InChI=1S/C22H27N7O4/c1-15(33-19(30)4-2-3-11-28(31)32)22-26-18-14-25-21-17(6-10-24-21)20(18)29(22)27-12-7-16(5-9-23)8-13-27/h6,10,14-16H,2-5,7-8,11-13H2,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | QIGMRSRSYCHSLT-OAHLLOKOSA-N |
| XLogP | 3.23 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|