C20H28N6O2 — CID 78042414
1-tert-butyl-3-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]urea (PubChem CID 78042414) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 78042414 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-tert-butyl-3-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCCc1nc2cnc3[nH]ccc3c2n1C1CCCOC1 |
| InChI | InChI=1S/C20H28N6O2/c1-20(2,3)25-19(27)22-9-7-16-24-15-11-23-18-14(6-8-21-18)17(15)26(16)13-5-4-10-28-12-13/h6,8,11,13H,4-5,7,9-10,12H2,1-3H3,(H,21,23)(H2,22,25,27) |
| InChIKey | JJYCEJLUBONLLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |