C20H27N5O2 — CID 78042408
2,2-dimethyl-N-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]propanamide (PubChem CID 78042408) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 78042408 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2,2-dimethyl-N-[2-[3-(oxan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCc1nc2cnc3[nH]ccc3c2n1C1CCCOC1 |
| InChI | InChI=1S/C20H27N5O2/c1-20(2,3)19(26)22-9-7-16-24-15-11-23-18-14(6-8-21-18)17(15)25(16)13-5-4-10-27-12-13/h6,8,11,13H,4-5,7,9-10,12H2,1-3H3,(H,21,23)(H,22,26) |
| InChIKey | GYGLNIFCMTUDMO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |