C23H31N3O3Si — CID 140773218
4-[4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]cyclohexane-1-carbaldehyde (PubChem CID 140773218) has the molecular formula C23H31N3O3Si and a molecular weight of 425.61 g/mol. Its IUPAC name is 4-[4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 140773218 |
| Molecular Formula | C23H31N3O3Si |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[4-oxo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]cyclohexane-1-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1c(=O)ccn(C3CCC(C=O)CC3)c12 |
| InChI | InChI=1S/C23H31N3O3Si/c1-30(2,3)13-12-29-16-25-10-8-19-22-20(14-24-23(19)25)21(28)9-11-26(22)18-6-4-17(15-27)5-7-18/h8-11,14-15,17-18H,4-7,12-13,16H2,1-3H3 |
| InChIKey | XNWUYINHCBRIPT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|