C26H33N5O5Si — CID 123566782
1-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 123566782) has the molecular formula C26H33N5O5Si and a molecular weight of 523.67 g/mol. Its IUPAC name is 1-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 123566782 |
| Molecular Formula | C26H33N5O5Si |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1c(=O)ccn(C3CCN(Cc4ccc([N+](=O)[O-])o4)CC3)c12 |
| InChI | InChI=1S/C26H33N5O5Si/c1-37(2,3)15-14-35-18-29-12-8-21-25-22(16-27-26(21)29)23(32)9-13-30(25)19-6-10-28(11-7-19)17-20-4-5-24(36-20)31(33)34/h4-5,8-9,12-13,16,19H,6-7,10-11,14-15,17-18H2,1-3H3 |
| InChIKey | SANGVMJZYOYBEN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 108.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|