C26H38N4O2Si — CID 58078505
[4-[(1-benzylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol (PubChem CID 58078505) has the molecular formula C26H38N4O2Si and a molecular weight of 466.70 g/mol. Its IUPAC name is [4-[(1-benzylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol.
| Compound Name | [4-[(1-benzylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 58078505 |
| Molecular Formula | C26H38N4O2Si |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | [4-[(1-benzylpiperidin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(NC3CCN(Cc4ccccc4)CC3)c(CO)cnc21 |
| InChI | InChI=1S/C26H38N4O2Si/c1-33(2,3)16-15-32-20-30-14-11-24-25(22(19-31)17-27-26(24)30)28-23-9-12-29(13-10-23)18-21-7-5-4-6-8-21/h4-8,11,14,17,23,31H,9-10,12-13,15-16,18-20H2,1-3H3,(H,27,28) |
| InChIKey | XCLWUXMVYPTERN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|