C25H38N6OSi — CID 89411342
4-[[4-[amino-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]piperidin-1-yl]methyl]aniline (PubChem CID 89411342) has the molecular formula C25H38N6OSi and a molecular weight of 466.71 g/mol. Its IUPAC name is 4-[[4-[amino-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]piperidin-1-yl]methyl]aniline.
| Compound Name | 4-[[4-[amino-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]piperidin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 89411342 |
| Molecular Formula | C25H38N6OSi |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 4-[[4-[amino-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]piperidin-1-yl]methyl]aniline |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(C(N)C3CCN(Cc4ccc(N)cc4)CC3)ncnc21 |
| InChI | InChI=1S/C25H38N6OSi/c1-33(2,3)15-14-32-18-31-13-10-22-24(28-17-29-25(22)31)23(27)20-8-11-30(12-9-20)16-19-4-6-21(26)7-5-19/h4-7,10,13,17,20,23H,8-9,11-12,14-16,18,26-27H2,1-3H3 |
| InChIKey | PTHRBSBURVJMKE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|