C16H23N5OSi — CID 141450640
4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrol-3-amine (PubChem CID 141450640) has the molecular formula C16H23N5OSi and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrol-3-amine.
| Compound Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 141450640 |
| Molecular Formula | C16H23N5OSi |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1H-pyrrol-3-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3c[nH]cc3N)ncnc21 |
| InChI | InChI=1S/C16H23N5OSi/c1-23(2,3)7-6-22-11-21-5-4-12-15(19-10-20-16(12)21)13-8-18-9-14(13)17/h4-5,8-10,18H,6-7,11,17H2,1-3H3 |
| InChIKey | HZTKHFANRHUVNH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|