C22H34N4O3Si — CID 142408656
ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-5-azaspiro[2.5]octane-8-carboxylate (PubChem CID 142408656) has the molecular formula C22H34N4O3Si and a molecular weight of 430.63 g/mol. Its IUPAC name is ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-5-azaspiro[2.5]octane-8-carboxylate.
| Compound Name | ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-5-azaspiro[2.5]octane-8-carboxylate |
|---|---|
| PubChem CID | 142408656 |
| Molecular Formula | C22H34N4O3Si |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | ethyl 5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-5-azaspiro[2.5]octane-8-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc3c2ccn3COCC[Si](C)(C)C)CC12CC2 |
| InChI | InChI=1S/C22H34N4O3Si/c1-5-29-21(27)18-7-11-25(14-22(18)8-9-22)19-17-6-10-26(20(17)24-15-23-19)16-28-12-13-30(2,3)4/h6,10,15,18H,5,7-9,11-14,16H2,1-4H3 |
| InChIKey | GQILYKCYCZFONW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|