C21H33N5O2Si — CID 153297374
8a-methyl-7-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3,4,4a,5,6,8-hexahydro-2H-2,7-naphthyridin-1-one (PubChem CID 153297374) has the molecular formula C21H33N5O2Si and a molecular weight of 415.61 g/mol. Its IUPAC name is 8a-methyl-7-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3,4,4a,5,6,8-hexahydro-2H-2,7-naphthyridin-1-one.
| Compound Name | 8a-methyl-7-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3,4,4a,5,6,8-hexahydro-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 153297374 |
| Molecular Formula | C21H33N5O2Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 8a-methyl-7-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3,4,4a,5,6,8-hexahydro-2H-2,7-naphthyridin-1-one |
| SMILES | CC12CN(c3ncnc4c3ccn4COCC[Si](C)(C)C)CCC1CCNC2=O |
| InChI | InChI=1S/C21H33N5O2Si/c1-21-13-25(9-6-16(21)5-8-22-20(21)27)18-17-7-10-26(19(17)24-14-23-18)15-28-11-12-29(2,3)4/h7,10,14,16H,5-6,8-9,11-13,15H2,1-4H3,(H,22,27) |
| InChIKey | JCZXQEBGCIUKTA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|