C19H27BrN4O2Si — CID 156747126
2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,6-diazaspiro[3.4]octan-5-one (PubChem CID 156747126) has the molecular formula C19H27BrN4O2Si and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,6-diazaspiro[3.4]octan-5-one.
| Compound Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,6-diazaspiro[3.4]octan-5-one |
|---|---|
| PubChem CID | 156747126 |
| Molecular Formula | C19H27BrN4O2Si |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2,6-diazaspiro[3.4]octan-5-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N3CC4(CCNC4=O)C3)c(Br)cnc21 |
| InChI | InChI=1S/C19H27BrN4O2Si/c1-27(2,3)9-8-26-13-23-7-4-14-16(15(20)10-22-17(14)23)24-11-19(12-24)5-6-21-18(19)25/h4,7,10H,5-6,8-9,11-13H2,1-3H3,(H,21,25) |
| InChIKey | QXHOOBPPYSOHMY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|