C20H29BrN4O3Si — CID 156747121
8-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 156747121) has the molecular formula C20H29BrN4O3Si and a molecular weight of 481.47 g/mol. Its IUPAC name is 8-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 156747121 |
| Molecular Formula | C20H29BrN4O3Si |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 8-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N3CCC4(CC3)CNC(=O)O4)c(Br)cnc21 |
| InChI | InChI=1S/C20H29BrN4O3Si/c1-29(2,3)11-10-27-14-25-7-4-15-17(16(21)12-22-18(15)25)24-8-5-20(6-9-24)13-23-19(26)28-20/h4,7,12H,5-6,8-11,13-14H2,1-3H3,(H,23,26) |
| InChIKey | VMOUXIUJKDSCSQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|