C16H23ClN2O2Si — CID 71258460
1-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]propan-1-one (PubChem CID 71258460) has the molecular formula C16H23ClN2O2Si and a molecular weight of 338.91 g/mol. Its IUPAC name is 1-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]propan-1-one.
| Compound Name | 1-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 71258460 |
| Molecular Formula | C16H23ClN2O2Si |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]propan-1-one |
| SMILES | CCC(=O)c1cnc2c(ccn2COCC[Si](C)(C)C)c1Cl |
| InChI | InChI=1S/C16H23ClN2O2Si/c1-5-14(20)13-10-18-16-12(15(13)17)6-7-19(16)11-21-8-9-22(2,3)4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | PWHCEKVQBXRDHQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|