C20H24FN3O2Si — CID 139945913
2-fluoro-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzamide (PubChem CID 139945913) has the molecular formula C20H24FN3O2Si and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-fluoro-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzamide.
| Compound Name | 2-fluoro-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzamide |
|---|---|
| PubChem CID | 139945913 |
| Molecular Formula | C20H24FN3O2Si |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-fluoro-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(NC(=O)c3ccccc3F)ccnc21 |
| InChI | InChI=1S/C20H24FN3O2Si/c1-27(2,3)13-12-26-14-24-11-9-16-18(8-10-22-19(16)24)23-20(25)15-6-4-5-7-17(15)21/h4-11H,12-14H2,1-3H3,(H,22,23,25) |
| InChIKey | HGWAWJQAKAMSLL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|