C29H49N3O2Si2 — CID 142711063
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 142711063) has the molecular formula C29H49N3O2Si2 and a molecular weight of 527.90 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 142711063 |
| Molecular Formula | C29H49N3O2Si2 |
| Molecular Weight | 527.90 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC12CC3CC(C1)C(Nc1ccnc4c1ccn4COCC[Si](C)(C)C)C(C3)C2 |
| InChI | InChI=1S/C29H49N3O2Si2/c1-28(2,3)36(7,8)34-29-17-21-15-22(18-29)26(23(16-21)19-29)31-25-9-11-30-27-24(25)10-12-32(27)20-33-13-14-35(4,5)6/h9-12,21-23,26H,13-20H2,1-8H3,(H,30,31) |
| InChIKey | UUVCKEDGLDBSTK-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.90 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|