C17H24N4OSi — CID 140923764
trimethyl-[2-[[4-(5-methyl-1H-pyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 140923764) has the molecular formula C17H24N4OSi and a molecular weight of 328.49 g/mol. Its IUPAC name is trimethyl-[2-[[4-(5-methyl-1H-pyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-(5-methyl-1H-pyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 140923764 |
| Molecular Formula | C17H24N4OSi |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | trimethyl-[2-[[4-(5-methyl-1H-pyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1[nH]ncc1-c1ccnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H24N4OSi/c1-13-16(11-19-20-13)14-5-7-18-17-15(14)6-8-21(17)12-22-9-10-23(2,3)4/h5-8,11H,9-10,12H2,1-4H3,(H,19,20) |
| InChIKey | HMBKIQFFOJBSQK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|