C23H32N6OSi — CID 68910657
trimethyl-[2-[[4-[1-[4-(1H-pyrazol-4-yl)butan-2-yl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 68910657) has the molecular formula C23H32N6OSi and a molecular weight of 436.64 g/mol. Its IUPAC name is trimethyl-[2-[[4-[1-[4-(1H-pyrazol-4-yl)butan-2-yl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-[1-[4-(1H-pyrazol-4-yl)butan-2-yl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 68910657 |
| Molecular Formula | C23H32N6OSi |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | trimethyl-[2-[[4-[1-[4-(1H-pyrazol-4-yl)butan-2-yl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | CC(CCc1cn[nH]c1)n1cc(-c2ccnc3c2ccn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C23H32N6OSi/c1-18(5-6-19-13-25-26-14-19)29-16-20(15-27-29)21-7-9-24-23-22(21)8-10-28(23)17-30-11-12-31(2,3)4/h7-10,13-16,18H,5-6,11-12,17H2,1-4H3,(H,25,26) |
| InChIKey | DUWHPJCILILCBI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|