C19H23F3N6OSi — CID 57477649
4,4,4-trifluoro-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile (PubChem CID 57477649) has the molecular formula C19H23F3N6OSi and a molecular weight of 436.51 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 4,4,4-trifluoro-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 57477649 |
| Molecular Formula | C19H23F3N6OSi |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4,4,4-trifluoro-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)C(F)(F)F)c3)ncnc21 |
| InChI | InChI=1S/C19H23F3N6OSi/c1-30(2,3)9-8-29-13-27-7-5-15-17(24-12-25-18(15)27)14-10-26-28(11-14)16(4-6-23)19(20,21)22/h5,7,10-12,16H,4,8-9,13H2,1-3H3 |
| InChIKey | CYLQGXNZAAKONL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|