C38H51N13O2Si2 — CID 142797344
2,2-bis[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 142797344) has the molecular formula C38H51N13O2Si2 and a molecular weight of 778.09 g/mol. Its IUPAC name is 2,2-bis[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2,2-bis[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 142797344 |
| Molecular Formula | C38H51N13O2Si2 |
| Molecular Weight | 778.09 g/mol |
| Exact Mass | 777.38 |
| IUPAC Name | 2,2-bis[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(C(C#N)C5(n6cc(-c7ncnc8c7ccn8COCC[Si](C)(C)C)cn6)CNC5)CNC4)c3)ncnc21 |
| InChI | InChI=1S/C38H51N13O2Si2/c1-54(2,3)13-11-52-26-48-9-7-30-33(42-24-44-35(30)48)28-16-46-50(18-28)37(20-40-21-37)32(15-39)38(22-41-23-38)51-19-29(17-47-51)34-31-8-10-49(36(31)45-25-43-34)27-53-12-14-55(4,5)6/h7-10,16-19,24-25,32,40-41H,11-14,20-23,26-27H2,1-6H3 |
| InChIKey | BNVGRTJBDSIOLX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.09 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|