C19H24N7OS+ — CID 148505964
2-[[4-[1-[3-(cyanomethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 148505964) has the molecular formula C19H24N7OS+ and a molecular weight of 398.52 g/mol. Its IUPAC name is 2-[[4-[1-[3-(cyanomethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[4-[1-[3-(cyanomethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 148505964 |
| Molecular Formula | C19H24N7OS+ |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[[4-[1-[3-(cyanomethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | C[S+](C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CNC4)c3)ncnc21 |
| InChI | InChI=1S/C19H24N7OS/c1-28(2)8-7-27-14-25-6-3-16-17(22-13-23-18(16)25)15-9-24-26(10-15)19(4-5-20)11-21-12-19/h3,6,9-10,13,21H,4,7-8,11-12,14H2,1-2H3/q+1 |
| InChIKey | MLOTTWDQWOSNMP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|