C56H78N14O2Si2 — CID 157052135
2-[1-(3-bicyclo[3.2.1]octanyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 157052135) has the molecular formula C56H78N14O2Si2 and a molecular weight of 1035.51 g/mol. Its IUPAC name is 2-[1-(3-bicyclo[3.2.1]octanyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-(3-bicyclo[3.2.1]octanyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 157052135 |
| Molecular Formula | C56H78N14O2Si2 |
| Molecular Weight | 1035.51 g/mol |
| Exact Mass | 1034.60 |
| IUPAC Name | 2-[1-(3-bicyclo[3.2.1]octanyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CC6CCC(C6)C5)C4)c3)ncnc21.C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CC6CCC(C6)C5)C4)c3)ncnc21 |
| InChI | InChI=1S/2C28H39N7OSi/c2*1-37(2,3)11-10-36-20-33-9-6-25-26(30-19-31-27(25)33)23-15-32-35(16-23)28(7-8-29)17-34(18-28)24-13-21-4-5-22(12-21)14-24/h2*6,9,15-16,19,21-22,24H,4-5,7,10-14,17-18,20H2,1-3H3 |
| InChIKey | AAIGKFAOONOXPD-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 169.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.51 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|