C26H38N8O2Si — CID 58431399
2-[1-[(3S,4R)-3-methoxypiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 58431399) has the molecular formula C26H38N8O2Si and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-[1-[(3S,4R)-3-methoxypiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-[(3S,4R)-3-methoxypiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 58431399 |
| Molecular Formula | C26H38N8O2Si |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 2-[1-[(3S,4R)-3-methoxypiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CO[C@H]1CNCC[C@H]1N1CC(CC#N)(n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C26H38N8O2Si/c1-35-23-14-28-9-5-22(23)33-16-26(17-33,7-8-27)34-15-20(13-31-34)24-21-6-10-32(25(21)30-18-29-24)19-36-11-12-37(2,3)4/h6,10,13,15,18,22-23,28H,5,7,9,11-12,14,16-17,19H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | ZZRXUIIJOWPBJI-PKTZIBPZSA-N |
| XLogP | 2.91 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|