C26H38N8OSi — CID 67392038
2-[1-(4-methylpiperidin-4-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 67392038) has the molecular formula C26H38N8OSi and a molecular weight of 506.73 g/mol. Its IUPAC name is 2-[1-(4-methylpiperidin-4-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-(4-methylpiperidin-4-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 67392038 |
| Molecular Formula | C26H38N8OSi |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[1-(4-methylpiperidin-4-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CC1(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)CCNCC1 |
| InChI | InChI=1S/C26H38N8OSi/c1-25(7-10-28-11-8-25)33-17-26(18-33,6-9-27)34-16-21(15-31-34)23-22-5-12-32(24(22)30-19-29-23)20-35-13-14-36(2,3)4/h5,12,15-16,19,28H,6-8,10-11,13-14,17-18,20H2,1-4H3 |
| InChIKey | WEDWVHFORZEABA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|