C27H37N7O3SSi — CID 154631836
2-[2-cyclopropylsulfonyl-5-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile (PubChem CID 154631836) has the molecular formula C27H37N7O3SSi and a molecular weight of 567.79 g/mol. Its IUPAC name is 2-[2-cyclopropylsulfonyl-5-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile.
| Compound Name | 2-[2-cyclopropylsulfonyl-5-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 154631836 |
| Molecular Formula | C27H37N7O3SSi |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 2-[2-cyclopropylsulfonyl-5-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CC5CN(S(=O)(=O)C6CC6)CC5C4)c3)ncnc21 |
| InChI | InChI=1S/C27H37N7O3SSi/c1-39(2,3)11-10-37-19-32-9-6-24-25(29-18-30-26(24)32)22-14-31-34(17-22)27(7-8-28)12-20-15-33(16-21(20)13-27)38(35,36)23-4-5-23/h6,9,14,17-18,20-21,23H,4-5,7,10-13,15-16,19H2,1-3H3 |
| InChIKey | QPWHQKJCMNRNBZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 118.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|