C25H34N6O3SSi — CID 163210861
2-[1-(cyclopropylmethylsulfonyl)-3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 163210861) has the molecular formula C25H34N6O3SSi and a molecular weight of 526.74 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethylsulfonyl)-3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-(cyclopropylmethylsulfonyl)-3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 163210861 |
| Molecular Formula | C25H34N6O3SSi |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[1-(cyclopropylmethylsulfonyl)-3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3ccn(C4(CC#N)CN(S(=O)(=O)CC5CC5)C4)c3)ncnc21 |
| InChI | InChI=1S/C25H34N6O3SSi/c1-36(2,3)13-12-34-19-29-10-7-22-23(27-18-28-24(22)29)21-6-11-30(14-21)25(8-9-26)16-31(17-25)35(32,33)15-20-4-5-20/h6-7,10-11,14,18,20H,4-5,8,12-13,15-17,19H2,1-3H3 |
| InChIKey | IJZDTHPRIWTQNB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|